C19H40O6Si2 — CID 15344854
trans-(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-1,4-dihydroxycyclohexane-1-carboxylic acid (PubChem CID 15344854) has the molecular formula C19H40O6Si2 and a molecular weight of 420.70 g/mol. Its IUPAC name is trans-(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-1,4-dihydroxycyclohexane-1-carboxylic acid.
| Compound Name | trans-(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-1,4-dihydroxycyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 15344854 |
| Molecular Formula | C19H40O6Si2 |
| Molecular Weight | 420.70 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | trans-(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-1,4-dihydroxycyclohexane-1-carboxylic acid |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CC(O)(C(=O)O)C[C@@H](O[Si](C)(C)C(C)(C)C)C1O |
| InChI | InChI=1S/C19H40O6Si2/c1-17(2,3)26(7,8)24-13-11-19(23,16(21)22)12-14(15(13)20)25-27(9,10)18(4,5)6/h13-15,20,23H,11-12H2,1-10H3,(H,21,22)/t13-,14-,15?,19?/m1/s1 |
| InChIKey | BZUUQPRUCDZXNC-IUGDKWEMSA-N |
| XLogP | 3.74 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.70 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|