About [(2-isocyanatoacetyl)oxymethylcarbamoylamino]methyl 2-isocyanatoacetate
[(2-isocyanatoacetyl)oxymethylcarbamoylamino]methyl 2-isocyanatoacetate (PubChem CID 153448875) has the molecular formula C9H10N4O7
and a molecular weight of 286.20 g/mol. Its IUPAC name is [(2-isocyanatoacetyl)oxymethylcarbamoylamino]methyl 2-isocyanatoacetate.
Molecular Properties
| Compound Name | [(2-isocyanatoacetyl)oxymethylcarbamoylamino]methyl 2-isocyanatoacetate |
| PubChem CID | 153448875 |
| Molecular Formula | C9H10N4O7 |
| Molecular Weight | 286.20 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | [(2-isocyanatoacetyl)oxymethylcarbamoylamino]methyl 2-isocyanatoacetate |
| SMILES | O=C=NCC(=O)OCNC(=O)NCOC(=O)CN=C=O |
| InChI | InChI=1S/C9H10N4O7/c14-3-10-1-7(16)19-5-12-9(18)13-6-20-8(17)2-11-4-15/h1-2,5-6H2,(H2,12,13,18) |
| InChIKey | FUGXCDLEOURMMK-UHFFFAOYSA-N |
| XLogP | -2.04 |
| TPSA | 152.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.20 |
| LogP ≤ 5 | -2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze [(2-isocyanatoacetyl)oxymethylcarbamoylamino]methyl 2-isocyanatoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2-isocyanatoacetyl)oxymethylcarbamoylamino]methyl 2-isocyanatoacetate?
The IUPAC name of [(2-isocyanatoacetyl)oxymethylcarbamoylamino]methyl 2-isocyanatoacetate (CID 153448875) is [(2-isocyanatoacetyl)oxymethylcarbamoylamino]methyl 2-isocyanatoacetate.
What is the SMILES notation for [(2-isocyanatoacetyl)oxymethylcarbamoylamino]methyl 2-isocyanatoacetate?
The canonical SMILES for [(2-isocyanatoacetyl)oxymethylcarbamoylamino]methyl 2-isocyanatoacetate is O=C=NCC(=O)OCNC(=O)NCOC(=O)CN=C=O.
What is the InChIKey of [(2-isocyanatoacetyl)oxymethylcarbamoylamino]methyl 2-isocyanatoacetate?
The InChIKey is FUGXCDLEOURMMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4O7/c14-3-10-1-7(16)19-5-12-9(18)13-6-20-8(17)2-11-4-15/h1-2,5-6H2,(H2,12,13,18).
What are the key properties of [(2-isocyanatoacetyl)oxymethylcarbamoylamino]methyl 2-isocyanatoacetate?
[(2-isocyanatoacetyl)oxymethylcarbamoylamino]methyl 2-isocyanatoacetate has a molecular weight of 286.20 g/mol, XLogP of -2.04, 8 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for [(2-isocyanatoacetyl)oxymethylcarbamoylamino]methyl 2-isocyanatoacetate is sourced from PubChem (CID 153448875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).