C15H7BrO2S — CID 153449992
8-bromo-[1]benzothiolo[3,2-b]chromen-11-one (PubChem CID 153449992) has the molecular formula C15H7BrO2S and a molecular weight of 331.19 g/mol. Its IUPAC name is 8-bromo-[1]benzothiolo[3,2-b]chromen-11-one.
| Compound Name | 8-bromo-[1]benzothiolo[3,2-b]chromen-11-one |
|---|---|
| PubChem CID | 153449992 |
| Molecular Formula | C15H7BrO2S |
| Molecular Weight | 331.19 g/mol |
| Exact Mass | 329.94 |
| IUPAC Name | 8-bromo-[1]benzothiolo[3,2-b]chromen-11-one |
| SMILES | O=c1c2ccccc2oc2c1sc1cc(Br)ccc12 |
| InChI | InChI=1S/C15H7BrO2S/c16-8-5-6-10-12(7-8)19-15-13(17)9-3-1-2-4-11(9)18-14(10)15/h1-7H |
| InChIKey | HSDADPDGGSBTMA-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.19 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |