C30H43N5O5Si — CID 153450161
propyl 4-[[(3R,6S)-6-methyl-1-phenylmethoxycarbonylpiperidin-3-yl]amino]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidine-5-carboxylate (PubChem CID 153450161) has the molecular formula C30H43N5O5Si and a molecular weight of 581.79 g/mol. Its IUPAC name is propyl 4-[[(3R,6S)-6-methyl-1-phenylmethoxycarbonylpiperidin-3-yl]amino]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidine-5-carboxylate.
| Compound Name | propyl 4-[[(3R,6S)-6-methyl-1-phenylmethoxycarbonylpiperidin-3-yl]amino]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 153450161 |
| Molecular Formula | C30H43N5O5Si |
| Molecular Weight | 581.79 g/mol |
| Exact Mass | 581.30 |
| IUPAC Name | propyl 4-[[(3R,6S)-6-methyl-1-phenylmethoxycarbonylpiperidin-3-yl]amino]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidine-5-carboxylate |
| SMILES | CCCOC(=O)c1cn(COCC[Si](C)(C)C)c2ncnc(N[C@@H]3CC[C@H](C)N(C(=O)OCc4ccccc4)C3)c12 |
| InChI | InChI=1S/C30H43N5O5Si/c1-6-14-39-29(36)25-18-34(21-38-15-16-41(3,4)5)28-26(25)27(31-20-32-28)33-24-13-12-22(2)35(17-24)30(37)40-19-23-10-8-7-9-11-23/h7-11,18,20,22,24H,6,12-17,19,21H2,1-5H3,(H,31,32,33)/t22-,24+/m0/s1 |
| InChIKey | ILYSWUFYIJLSEP-LADGPHEKSA-N |
| XLogP | 5.91 |
| TPSA | 107.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.79 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|