C29H41N5O5Si — CID 153450175
ethyl 4-[[(3R,6S)-6-methyl-1-phenylmethoxycarbonylpiperidin-3-yl]amino]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidine-5-carboxylate (PubChem CID 153450175) has the molecular formula C29H41N5O5Si and a molecular weight of 567.76 g/mol. Its IUPAC name is ethyl 4-[[(3R,6S)-6-methyl-1-phenylmethoxycarbonylpiperidin-3-yl]amino]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidine-5-carboxylate.
| Compound Name | ethyl 4-[[(3R,6S)-6-methyl-1-phenylmethoxycarbonylpiperidin-3-yl]amino]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 153450175 |
| Molecular Formula | C29H41N5O5Si |
| Molecular Weight | 567.76 g/mol |
| Exact Mass | 567.29 |
| IUPAC Name | ethyl 4-[[(3R,6S)-6-methyl-1-phenylmethoxycarbonylpiperidin-3-yl]amino]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cn(COCC[Si](C)(C)C)c2ncnc(N[C@@H]3CC[C@H](C)N(C(=O)OCc4ccccc4)C3)c12 |
| InChI | InChI=1S/C29H41N5O5Si/c1-6-38-28(35)24-17-33(20-37-14-15-40(3,4)5)27-25(24)26(30-19-31-27)32-23-13-12-21(2)34(16-23)29(36)39-18-22-10-8-7-9-11-22/h7-11,17,19,21,23H,6,12-16,18,20H2,1-5H3,(H,30,31,32)/t21-,23+/m0/s1 |
| InChIKey | HVZIBNKBVKGROT-JTHBVZDNSA-N |
| XLogP | 5.52 |
| TPSA | 107.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.76 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|