C13H11Br3NOY- — CID 153450438
3-bromo-6-(2,4-dibromophenyl)-1-ethyl-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium (PubChem CID 153450438) has the molecular formula C13H11Br3NOY- and a molecular weight of 525.86 g/mol. Its IUPAC name is 3-bromo-6-(2,4-dibromophenyl)-1-ethyl-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium.
| Compound Name | 3-bromo-6-(2,4-dibromophenyl)-1-ethyl-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium |
|---|---|
| PubChem CID | 153450438 |
| Molecular Formula | C13H11Br3NOY- |
| Molecular Weight | 525.86 g/mol |
| Exact Mass | 522.75 |
| IUPAC Name | 3-bromo-6-(2,4-dibromophenyl)-1-ethyl-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium |
| SMILES | CCN1C(=O)C(Br)C[C-]=C1c1ccc(Br)cc1Br.[Y] |
| InChI | InChI=1S/C13H11Br3NO.Y/c1-2-17-12(6-5-10(15)13(17)18)9-4-3-8(14)7-11(9)16;/h3-4,7,10H,2,5H2,1H3;/q-1; |
| InChIKey | MOORIBOVVPAVSA-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.86 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|