C15H14F4INO2S — CID 153450535
1-(2,2-difluoroethyl)-6-[2,6-difluoro-4-(methylsulfanylmethoxy)phenyl]-3-iodo-3,4-dihydropyridin-2-one (PubChem CID 153450535) has the molecular formula C15H14F4INO2S and a molecular weight of 475.25 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-6-[2,6-difluoro-4-(methylsulfanylmethoxy)phenyl]-3-iodo-3,4-dihydropyridin-2-one.
| Compound Name | 1-(2,2-difluoroethyl)-6-[2,6-difluoro-4-(methylsulfanylmethoxy)phenyl]-3-iodo-3,4-dihydropyridin-2-one |
|---|---|
| PubChem CID | 153450535 |
| Molecular Formula | C15H14F4INO2S |
| Molecular Weight | 475.25 g/mol |
| Exact Mass | 474.97 |
| IUPAC Name | 1-(2,2-difluoroethyl)-6-[2,6-difluoro-4-(methylsulfanylmethoxy)phenyl]-3-iodo-3,4-dihydropyridin-2-one |
| SMILES | CSCOc1cc(F)c(C2=CCC(I)C(=O)N2CC(F)F)c(F)c1 |
| InChI | InChI=1S/C15H14F4INO2S/c1-24-7-23-8-4-9(16)14(10(17)5-8)12-3-2-11(20)15(22)21(12)6-13(18)19/h3-5,11,13H,2,6-7H2,1H3 |
| InChIKey | JQMCJEAFQSNQSF-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.25 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|