C13H12Br2ClNO — CID 153450717
3-bromo-6-(2-bromo-4-chlorophenyl)-1-ethyl-3,4-dihydropyridin-2-one (PubChem CID 153450717) has the molecular formula C13H12Br2ClNO and a molecular weight of 393.51 g/mol. Its IUPAC name is 3-bromo-6-(2-bromo-4-chlorophenyl)-1-ethyl-3,4-dihydropyridin-2-one.
| Compound Name | 3-bromo-6-(2-bromo-4-chlorophenyl)-1-ethyl-3,4-dihydropyridin-2-one |
|---|---|
| PubChem CID | 153450717 |
| Molecular Formula | C13H12Br2ClNO |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 390.90 |
| IUPAC Name | 3-bromo-6-(2-bromo-4-chlorophenyl)-1-ethyl-3,4-dihydropyridin-2-one |
| SMILES | CCN1C(=O)C(Br)CC=C1c1ccc(Cl)cc1Br |
| InChI | InChI=1S/C13H12Br2ClNO/c1-2-17-12(6-5-10(14)13(17)18)9-4-3-8(16)7-11(9)15/h3-4,6-7,10H,2,5H2,1H3 |
| InChIKey | RCCLCYDDJWNBQR-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|