C14H14F2INO3 — CID 153450935
6-[2,6-difluoro-4-(methoxymethoxy)phenyl]-3-iodo-1-methyl-3,4-dihydropyridin-2-one (PubChem CID 153450935) has the molecular formula C14H14F2INO3 and a molecular weight of 409.17 g/mol. Its IUPAC name is 6-[2,6-difluoro-4-(methoxymethoxy)phenyl]-3-iodo-1-methyl-3,4-dihydropyridin-2-one.
| Compound Name | 6-[2,6-difluoro-4-(methoxymethoxy)phenyl]-3-iodo-1-methyl-3,4-dihydropyridin-2-one |
|---|---|
| PubChem CID | 153450935 |
| Molecular Formula | C14H14F2INO3 |
| Molecular Weight | 409.17 g/mol |
| Exact Mass | 409.00 |
| IUPAC Name | 6-[2,6-difluoro-4-(methoxymethoxy)phenyl]-3-iodo-1-methyl-3,4-dihydropyridin-2-one |
| SMILES | COCOc1cc(F)c(C2=CCC(I)C(=O)N2C)c(F)c1 |
| InChI | InChI=1S/C14H14F2INO3/c1-18-12(4-3-11(17)14(18)19)13-9(15)5-8(6-10(13)16)21-7-20-2/h4-6,11H,3,7H2,1-2H3 |
| InChIKey | PEYNYGOXGSBOLE-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.17 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|