About 6-[2,6-difluoro-4-(2-methoxyethoxy)phenyl]-1-ethyl-3-iodo-3,4-dihydropyridin-2-one
6-[2,6-difluoro-4-(2-methoxyethoxy)phenyl]-1-ethyl-3-iodo-3,4-dihydropyridin-2-one (PubChem CID 153451159) has the molecular formula C16H18F2INO3
and a molecular weight of 437.22 g/mol. Its IUPAC name is 6-[2,6-difluoro-4-(2-methoxyethoxy)phenyl]-1-ethyl-3-iodo-3,4-dihydropyridin-2-one.
Molecular Properties
| Compound Name | 6-[2,6-difluoro-4-(2-methoxyethoxy)phenyl]-1-ethyl-3-iodo-3,4-dihydropyridin-2-one |
| PubChem CID | 153451159 |
| Molecular Formula | C16H18F2INO3 |
| Molecular Weight | 437.22 g/mol |
| Exact Mass | 437.03 |
| IUPAC Name | 6-[2,6-difluoro-4-(2-methoxyethoxy)phenyl]-1-ethyl-3-iodo-3,4-dihydropyridin-2-one |
| SMILES | CCN1C(=O)C(I)CC=C1c1c(F)cc(OCCOC)cc1F |
| InChI | InChI=1S/C16H18F2INO3/c1-3-20-14(5-4-13(19)16(20)21)15-11(17)8-10(9-12(15)18)23-7-6-22-2/h5,8-9,13H,3-4,6-7H2,1-2H3 |
| InChIKey | FLVOCVPRTOPDPW-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 437.22 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 6-[2,6-difluoro-4-(2-methoxyethoxy)phenyl]-1-ethyl-3-iodo-3,4-dihydropyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[2,6-difluoro-4-(2-methoxyethoxy)phenyl]-1-ethyl-3-iodo-3,4-dihydropyridin-2-one?
The IUPAC name of 6-[2,6-difluoro-4-(2-methoxyethoxy)phenyl]-1-ethyl-3-iodo-3,4-dihydropyridin-2-one (CID 153451159) is 6-[2,6-difluoro-4-(2-methoxyethoxy)phenyl]-1-ethyl-3-iodo-3,4-dihydropyridin-2-one.
What is the SMILES notation for 6-[2,6-difluoro-4-(2-methoxyethoxy)phenyl]-1-ethyl-3-iodo-3,4-dihydropyridin-2-one?
The canonical SMILES for 6-[2,6-difluoro-4-(2-methoxyethoxy)phenyl]-1-ethyl-3-iodo-3,4-dihydropyridin-2-one is CCN1C(=O)C(I)CC=C1c1c(F)cc(OCCOC)cc1F.
What is the InChIKey of 6-[2,6-difluoro-4-(2-methoxyethoxy)phenyl]-1-ethyl-3-iodo-3,4-dihydropyridin-2-one?
The InChIKey is FLVOCVPRTOPDPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18F2INO3/c1-3-20-14(5-4-13(19)16(20)21)15-11(17)8-10(9-12(15)18)23-7-6-22-2/h5,8-9,13H,3-4,6-7H2,1-2H3.
What are the key properties of 6-[2,6-difluoro-4-(2-methoxyethoxy)phenyl]-1-ethyl-3-iodo-3,4-dihydropyridin-2-one?
6-[2,6-difluoro-4-(2-methoxyethoxy)phenyl]-1-ethyl-3-iodo-3,4-dihydropyridin-2-one has a molecular weight of 437.22 g/mol, XLogP of 3.39, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[2,6-difluoro-4-(2-methoxyethoxy)phenyl]-1-ethyl-3-iodo-3,4-dihydropyridin-2-one is sourced from PubChem (CID 153451159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).