C13H10F3INO2Y- — CID 153451260
1-(2,2-difluoroethyl)-6-(2-fluoro-4-hydroxyphenyl)-3-iodo-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium (PubChem CID 153451260) has the molecular formula C13H10F3INO2Y- and a molecular weight of 485.03 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-6-(2-fluoro-4-hydroxyphenyl)-3-iodo-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium.
| Compound Name | 1-(2,2-difluoroethyl)-6-(2-fluoro-4-hydroxyphenyl)-3-iodo-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium |
|---|---|
| PubChem CID | 153451260 |
| Molecular Formula | C13H10F3INO2Y- |
| Molecular Weight | 485.03 g/mol |
| Exact Mass | 484.88 |
| IUPAC Name | 1-(2,2-difluoroethyl)-6-(2-fluoro-4-hydroxyphenyl)-3-iodo-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium |
| SMILES | O=C1C(I)C[C-]=C(c2ccc(O)cc2F)N1CC(F)F.[Y] |
| InChI | InChI=1S/C13H10F3INO2.Y/c14-9-5-7(19)1-2-8(9)11-4-3-10(17)13(20)18(11)6-12(15)16;/h1-2,5,10,12,19H,3,6H2;/q-1; |
| InChIKey | DRRJLJHPDYJISY-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.03 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|