C17H17BrClNO2 — CID 153451291
3-bromo-6-(4-but-2-ynoxy-2-chlorophenyl)-1-ethyl-3,4-dihydropyridin-2-one (PubChem CID 153451291) has the molecular formula C17H17BrClNO2 and a molecular weight of 382.69 g/mol. Its IUPAC name is 3-bromo-6-(4-but-2-ynoxy-2-chlorophenyl)-1-ethyl-3,4-dihydropyridin-2-one.
| Compound Name | 3-bromo-6-(4-but-2-ynoxy-2-chlorophenyl)-1-ethyl-3,4-dihydropyridin-2-one |
|---|---|
| PubChem CID | 153451291 |
| Molecular Formula | C17H17BrClNO2 |
| Molecular Weight | 382.69 g/mol |
| Exact Mass | 381.01 |
| IUPAC Name | 3-bromo-6-(4-but-2-ynoxy-2-chlorophenyl)-1-ethyl-3,4-dihydropyridin-2-one |
| SMILES | CC#CCOc1ccc(C2=CCC(Br)C(=O)N2CC)c(Cl)c1 |
| InChI | InChI=1S/C17H17BrClNO2/c1-3-5-10-22-12-6-7-13(15(19)11-12)16-9-8-14(18)17(21)20(16)4-2/h6-7,9,11,14H,4,8,10H2,1-2H3 |
| InChIKey | CDBNIOBGPAQDRN-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.69 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|