C15H13F2N2O2Y- — CID 153451370
2-[4-(1-ethyl-6-oxo-4,5-dihydro-3H-pyridin-3-id-2-yl)-3,5-difluorophenoxy]acetonitrile;yttrium (PubChem CID 153451370) has the molecular formula C15H13F2N2O2Y- and a molecular weight of 380.18 g/mol. Its IUPAC name is 2-[4-(1-ethyl-6-oxo-4,5-dihydro-3H-pyridin-3-id-2-yl)-3,5-difluorophenoxy]acetonitrile;yttrium.
| Compound Name | 2-[4-(1-ethyl-6-oxo-4,5-dihydro-3H-pyridin-3-id-2-yl)-3,5-difluorophenoxy]acetonitrile;yttrium |
|---|---|
| PubChem CID | 153451370 |
| Molecular Formula | C15H13F2N2O2Y- |
| Molecular Weight | 380.18 g/mol |
| Exact Mass | 380.00 |
| IUPAC Name | 2-[4-(1-ethyl-6-oxo-4,5-dihydro-3H-pyridin-3-id-2-yl)-3,5-difluorophenoxy]acetonitrile;yttrium |
| SMILES | CCN1C(=O)CC[C-]=C1c1c(F)cc(OCC#N)cc1F.[Y] |
| InChI | InChI=1S/C15H13F2N2O2.Y/c1-2-19-13(4-3-5-14(19)20)15-11(16)8-10(9-12(15)17)21-7-6-18;/h8-9H,2-3,5,7H2,1H3;/q-1; |
| InChIKey | PGKIBEJLNXNCIK-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.18 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|