C17H18ClF2NO2 — CID 153451558
3-chloro-1-(2,2-difluoroethyl)-6-(2-methyl-4-prop-2-enoxyphenyl)-3,4-dihydropyridin-2-one (PubChem CID 153451558) has the molecular formula C17H18ClF2NO2 and a molecular weight of 341.79 g/mol. Its IUPAC name is 3-chloro-1-(2,2-difluoroethyl)-6-(2-methyl-4-prop-2-enoxyphenyl)-3,4-dihydropyridin-2-one.
| Compound Name | 3-chloro-1-(2,2-difluoroethyl)-6-(2-methyl-4-prop-2-enoxyphenyl)-3,4-dihydropyridin-2-one |
|---|---|
| PubChem CID | 153451558 |
| Molecular Formula | C17H18ClF2NO2 |
| Molecular Weight | 341.79 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | 3-chloro-1-(2,2-difluoroethyl)-6-(2-methyl-4-prop-2-enoxyphenyl)-3,4-dihydropyridin-2-one |
| SMILES | C=CCOc1ccc(C2=CCC(Cl)C(=O)N2CC(F)F)c(C)c1 |
| InChI | InChI=1S/C17H18ClF2NO2/c1-3-8-23-12-4-5-13(11(2)9-12)15-7-6-14(18)17(22)21(15)10-16(19)20/h3-5,7,9,14,16H,1,6,8,10H2,2H3 |
| InChIKey | OWDKSBZLGXICRX-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.79 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|