C16H20BrNO3 — CID 153451668
6-[2-bromo-4-(2-methoxyethoxy)phenyl]-1-ethyl-3,4-dihydropyridin-2-one (PubChem CID 153451668) has the molecular formula C16H20BrNO3 and a molecular weight of 354.24 g/mol. Its IUPAC name is 6-[2-bromo-4-(2-methoxyethoxy)phenyl]-1-ethyl-3,4-dihydropyridin-2-one.
| Compound Name | 6-[2-bromo-4-(2-methoxyethoxy)phenyl]-1-ethyl-3,4-dihydropyridin-2-one |
|---|---|
| PubChem CID | 153451668 |
| Molecular Formula | C16H20BrNO3 |
| Molecular Weight | 354.24 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | 6-[2-bromo-4-(2-methoxyethoxy)phenyl]-1-ethyl-3,4-dihydropyridin-2-one |
| SMILES | CCN1C(=O)CCC=C1c1ccc(OCCOC)cc1Br |
| InChI | InChI=1S/C16H20BrNO3/c1-3-18-15(5-4-6-16(18)19)13-8-7-12(11-14(13)17)21-10-9-20-2/h5,7-8,11H,3-4,6,9-10H2,1-2H3 |
| InChIKey | FMYCQLLORSCYLL-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.24 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|