About 1-hydroxyheptadecane-2,9-dione
1-hydroxyheptadecane-2,9-dione (PubChem CID 153452315) has the molecular formula C17H32O3
and a molecular weight of 284.44 g/mol. Its IUPAC name is 1-hydroxyheptadecane-2,9-dione.
Molecular Properties
| Compound Name | 1-hydroxyheptadecane-2,9-dione |
| PubChem CID | 153452315 |
| Molecular Formula | C17H32O3 |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.24 |
| IUPAC Name | 1-hydroxyheptadecane-2,9-dione |
| SMILES | CCCCCCCCC(=O)CCCCCCC(=O)CO |
| InChI | InChI=1S/C17H32O3/c1-2-3-4-5-6-9-12-16(19)13-10-7-8-11-14-17(20)15-18/h18H,2-15H2,1H3 |
| InChIKey | XJUJSNFQZIJPKF-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxyheptadecane-2,9-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxyheptadecane-2,9-dione?
The IUPAC name of 1-hydroxyheptadecane-2,9-dione (CID 153452315) is 1-hydroxyheptadecane-2,9-dione.
What is the SMILES notation for 1-hydroxyheptadecane-2,9-dione?
The canonical SMILES for 1-hydroxyheptadecane-2,9-dione is CCCCCCCCC(=O)CCCCCCC(=O)CO.
What is the InChIKey of 1-hydroxyheptadecane-2,9-dione?
The InChIKey is XJUJSNFQZIJPKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H32O3/c1-2-3-4-5-6-9-12-16(19)13-10-7-8-11-14-17(20)15-18/h18H,2-15H2,1H3.
What are the key properties of 1-hydroxyheptadecane-2,9-dione?
1-hydroxyheptadecane-2,9-dione has a molecular weight of 284.44 g/mol, XLogP of 4.21, 15 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxyheptadecane-2,9-dione is sourced from PubChem (CID 153452315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).