C19H18BF2NO5 — CID 153452974
2-[2-fluoro-4-[2-(4-fluorophenyl)ethoxy]phenyl]-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione (PubChem CID 153452974) has the molecular formula C19H18BF2NO5 and a molecular weight of 389.16 g/mol. Its IUPAC name is 2-[2-fluoro-4-[2-(4-fluorophenyl)ethoxy]phenyl]-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione.
| Compound Name | 2-[2-fluoro-4-[2-(4-fluorophenyl)ethoxy]phenyl]-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione |
|---|---|
| PubChem CID | 153452974 |
| Molecular Formula | C19H18BF2NO5 |
| Molecular Weight | 389.16 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | 2-[2-fluoro-4-[2-(4-fluorophenyl)ethoxy]phenyl]-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione |
| SMILES | CN1CC(=O)OB(c2ccc(OCCc3ccc(F)cc3)cc2F)OC(=O)C1 |
| InChI | InChI=1S/C19H18BF2NO5/c1-23-11-18(24)27-20(28-19(25)12-23)16-7-6-15(10-17(16)22)26-9-8-13-2-4-14(21)5-3-13/h2-7,10H,8-9,11-12H2,1H3 |
| InChIKey | XFDPOSYFTGBTBS-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.16 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|