C12H10F3N3O2 — CID 153453822
ethyl (E)-3-[3-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-7-yl]prop-2-enoate (PubChem CID 153453822) has the molecular formula C12H10F3N3O2 and a molecular weight of 285.23 g/mol. Its IUPAC name is ethyl (E)-3-[3-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-7-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[3-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-7-yl]prop-2-enoate |
|---|---|
| PubChem CID | 153453822 |
| Molecular Formula | C12H10F3N3O2 |
| Molecular Weight | 285.23 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | ethyl (E)-3-[3-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-7-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1ccn2c(C(F)(F)F)nnc2c1 |
| InChI | InChI=1S/C12H10F3N3O2/c1-2-20-10(19)4-3-8-5-6-18-9(7-8)16-17-11(18)12(13,14)15/h3-7H,2H2,1H3/b4-3+ |
| InChIKey | KXNDCSYHMXEZAH-ONEGZZNKSA-N |
| XLogP | 2.32 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.23 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|