C30H39ClN6O2Si — CID 153453970
5-(4-chloro-1,6-naphthyridin-2-yl)-N-(3-piperidin-1-ylpropyl)-1-(2-trimethylsilylethoxymethyl)benzimidazole-2-carboxamide (PubChem CID 153453970) has the molecular formula C30H39ClN6O2Si and a molecular weight of 579.22 g/mol. Its IUPAC name is 5-(4-chloro-1,6-naphthyridin-2-yl)-N-(3-piperidin-1-ylpropyl)-1-(2-trimethylsilylethoxymethyl)benzimidazole-2-carboxamide.
| Compound Name | 5-(4-chloro-1,6-naphthyridin-2-yl)-N-(3-piperidin-1-ylpropyl)-1-(2-trimethylsilylethoxymethyl)benzimidazole-2-carboxamide |
|---|---|
| PubChem CID | 153453970 |
| Molecular Formula | C30H39ClN6O2Si |
| Molecular Weight | 579.22 g/mol |
| Exact Mass | 578.26 |
| IUPAC Name | 5-(4-chloro-1,6-naphthyridin-2-yl)-N-(3-piperidin-1-ylpropyl)-1-(2-trimethylsilylethoxymethyl)benzimidazole-2-carboxamide |
| SMILES | C[Si](C)(C)CCOCn1c(C(=O)NCCCN2CCCCC2)nc2cc(-c3cc(Cl)c4cnccc4n3)ccc21 |
| InChI | InChI=1S/C30H39ClN6O2Si/c1-40(2,3)17-16-39-21-37-28-9-8-22(26-19-24(31)23-20-32-12-10-25(23)34-26)18-27(28)35-29(37)30(38)33-11-7-15-36-13-5-4-6-14-36/h8-10,12,18-20H,4-7,11,13-17,21H2,1-3H3,(H,33,38) |
| InChIKey | FLHIPTJIYBEMFK-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.22 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|