C30H40ClN7O2Si — CID 153453979
5-(4-chloro-1,6-naphthyridin-2-yl)-N-[3-(4-methylpiperazin-1-yl)propyl]-1-(2-trimethylsilylethoxymethyl)benzimidazole-2-carboxamide (PubChem CID 153453979) has the molecular formula C30H40ClN7O2Si and a molecular weight of 594.24 g/mol. Its IUPAC name is 5-(4-chloro-1,6-naphthyridin-2-yl)-N-[3-(4-methylpiperazin-1-yl)propyl]-1-(2-trimethylsilylethoxymethyl)benzimidazole-2-carboxamide.
| Compound Name | 5-(4-chloro-1,6-naphthyridin-2-yl)-N-[3-(4-methylpiperazin-1-yl)propyl]-1-(2-trimethylsilylethoxymethyl)benzimidazole-2-carboxamide |
|---|---|
| PubChem CID | 153453979 |
| Molecular Formula | C30H40ClN7O2Si |
| Molecular Weight | 594.24 g/mol |
| Exact Mass | 593.27 |
| IUPAC Name | 5-(4-chloro-1,6-naphthyridin-2-yl)-N-[3-(4-methylpiperazin-1-yl)propyl]-1-(2-trimethylsilylethoxymethyl)benzimidazole-2-carboxamide |
| SMILES | CN1CCN(CCCNC(=O)c2nc3cc(-c4cc(Cl)c5cnccc5n4)ccc3n2COCC[Si](C)(C)C)CC1 |
| InChI | InChI=1S/C30H40ClN7O2Si/c1-36-12-14-37(15-13-36)11-5-9-33-30(39)29-35-27-18-22(26-19-24(31)23-20-32-10-8-25(23)34-26)6-7-28(27)38(29)21-40-16-17-41(2,3)4/h6-8,10,18-20H,5,9,11-17,21H2,1-4H3,(H,33,39) |
| InChIKey | VREVGLWTFKTKEA-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.24 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|