C42H54N8O4Si — CID 153453992
tert-butyl 4-[5-[4-[4-(pyrrolidin-1-ylmethyl)anilino]-1,6-naphthyridin-2-yl]-1-(2-trimethylsilylethoxymethyl)benzimidazole-2-carbonyl]piperazine-1-carboxylate (PubChem CID 153453992) has the molecular formula C42H54N8O4Si and a molecular weight of 763.03 g/mol. Its IUPAC name is tert-butyl 4-[5-[4-[4-(pyrrolidin-1-ylmethyl)anilino]-1,6-naphthyridin-2-yl]-1-(2-trimethylsilylethoxymethyl)benzimidazole-2-carbonyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[5-[4-[4-(pyrrolidin-1-ylmethyl)anilino]-1,6-naphthyridin-2-yl]-1-(2-trimethylsilylethoxymethyl)benzimidazole-2-carbonyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 153453992 |
| Molecular Formula | C42H54N8O4Si |
| Molecular Weight | 763.03 g/mol |
| Exact Mass | 762.40 |
| IUPAC Name | tert-butyl 4-[5-[4-[4-(pyrrolidin-1-ylmethyl)anilino]-1,6-naphthyridin-2-yl]-1-(2-trimethylsilylethoxymethyl)benzimidazole-2-carbonyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)c2nc3cc(-c4cc(Nc5ccc(CN6CCCC6)cc5)c5cnccc5n4)ccc3n2COCC[Si](C)(C)C)CC1 |
| InChI | InChI=1S/C42H54N8O4Si/c1-42(2,3)54-41(52)49-21-19-48(20-22-49)40(51)39-46-37-25-31(11-14-38(37)50(39)29-53-23-24-55(4,5)6)35-26-36(33-27-43-16-15-34(33)45-35)44-32-12-9-30(10-13-32)28-47-17-7-8-18-47/h9-16,25-27H,7-8,17-24,28-29H2,1-6H3,(H,44,45) |
| InChIKey | DQOVIAGAAZDWRR-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 117.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.03 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|