C59H76F2N2O7 — CID 153454854
[7-[1,7-bis[[2-(2-methoxy-4-pentylphenyl)-1-methylindol-6-yl]oxy]heptan-4-yloxy]-4,4-difluoroheptyl] prop-2-enoate (PubChem CID 153454854) has the molecular formula C59H76F2N2O7 and a molecular weight of 963.26 g/mol. Its IUPAC name is [7-[1,7-bis[[2-(2-methoxy-4-pentylphenyl)-1-methylindol-6-yl]oxy]heptan-4-yloxy]-4,4-difluoroheptyl] prop-2-enoate.
| Compound Name | [7-[1,7-bis[[2-(2-methoxy-4-pentylphenyl)-1-methylindol-6-yl]oxy]heptan-4-yloxy]-4,4-difluoroheptyl] prop-2-enoate |
|---|---|
| PubChem CID | 153454854 |
| Molecular Formula | C59H76F2N2O7 |
| Molecular Weight | 963.26 g/mol |
| Exact Mass | 962.56 |
| IUPAC Name | [7-[1,7-bis[[2-(2-methoxy-4-pentylphenyl)-1-methylindol-6-yl]oxy]heptan-4-yloxy]-4,4-difluoroheptyl] prop-2-enoate |
| SMILES | C=CC(=O)OCCCC(F)(F)CCCOC(CCCOc1ccc2cc(-c3ccc(CCCCC)cc3OC)n(C)c2c1)CCCOc1ccc2cc(-c3ccc(CCCCC)cc3OC)n(C)c2c1 |
| InChI | InChI=1S/C59H76F2N2O7/c1-8-11-13-19-43-23-29-50(56(37-43)65-6)54-39-45-25-27-48(41-52(45)62(54)4)68-33-15-21-47(67-35-17-31-59(60,61)32-18-36-70-58(64)10-3)22-16-34-69-49-28-26-46-40-55(63(5)53(46)42-49)51-30-24-44(20-14-12-9-2)38-57(51)66-7/h10,23-30,37-42,47H,3,8-9,11-22,31-36H2,1-2,4-7H3 |
| InChIKey | DTVQEEGVZQNTQJ-UHFFFAOYSA-N |
| XLogP | 14.81 |
| TPSA | 82.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 963.26 |
| LogP ≤ 5 | 14.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|