C38H20N6 — CID 153455486
9-[2-[5-cyano-2-(3-isocyanocarbazol-9-yl)phenyl]-3-pyridinyl]carbazole-3-carbonitrile (PubChem CID 153455486) has the molecular formula C38H20N6 and a molecular weight of 560.62 g/mol. Its IUPAC name is 9-[2-[5-cyano-2-(3-isocyanocarbazol-9-yl)phenyl]-3-pyridinyl]carbazole-3-carbonitrile.
| Compound Name | 9-[2-[5-cyano-2-(3-isocyanocarbazol-9-yl)phenyl]-3-pyridinyl]carbazole-3-carbonitrile |
|---|---|
| PubChem CID | 153455486 |
| Molecular Formula | C38H20N6 |
| Molecular Weight | 560.62 g/mol |
| Exact Mass | 560.17 |
| IUPAC Name | 9-[2-[5-cyano-2-(3-isocyanocarbazol-9-yl)phenyl]-3-pyridinyl]carbazole-3-carbonitrile |
| SMILES | [C-]#[N+]c1ccc2c(c1)c1ccccc1n2-c1ccc(C#N)cc1-c1ncccc1-n1c2ccccc2c2cc(C#N)ccc21 |
| InChI | InChI=1S/C38H20N6/c1-41-26-14-17-35-30(21-26)28-8-3-4-9-32(28)43(35)36-16-13-25(23-40)20-31(36)38-37(11-6-18-42-38)44-33-10-5-2-7-27(33)29-19-24(22-39)12-15-34(29)44/h2-21H |
| InChIKey | BESOZEAEOSROHE-UHFFFAOYSA-N |
| XLogP | 9.24 |
| TPSA | 74.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.62 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|