C23H28ClF4NaO6S2Si — CID 153455938
sodium 3-[4-[1-chloro-3-[4-(2-trimethoxysilylethyl)phenyl]propyl]-2,3,5,6-tetrafluorophenyl]sulfanylpropane-1-sulfonate (PubChem CID 153455938) has the molecular formula C23H28ClF4NaO6S2Si and a molecular weight of 627.13 g/mol. Its IUPAC name is sodium 3-[4-[1-chloro-3-[4-(2-trimethoxysilylethyl)phenyl]propyl]-2,3,5,6-tetrafluorophenyl]sulfanylpropane-1-sulfonate.
| Compound Name | sodium 3-[4-[1-chloro-3-[4-(2-trimethoxysilylethyl)phenyl]propyl]-2,3,5,6-tetrafluorophenyl]sulfanylpropane-1-sulfonate |
|---|---|
| PubChem CID | 153455938 |
| Molecular Formula | C23H28ClF4NaO6S2Si |
| Molecular Weight | 627.13 g/mol |
| Exact Mass | 626.06 |
| IUPAC Name | sodium 3-[4-[1-chloro-3-[4-(2-trimethoxysilylethyl)phenyl]propyl]-2,3,5,6-tetrafluorophenyl]sulfanylpropane-1-sulfonate |
| SMILES | CO[Si](CCc1ccc(CCC(Cl)c2c(F)c(F)c(SCCCS(=O)(=O)[O-])c(F)c2F)cc1)(OC)OC.[Na+] |
| InChI | InChI=1S/C23H29ClF4O6S2Si.Na/c1-32-37(33-2,34-3)14-11-16-7-5-15(6-8-16)9-10-17(24)18-19(25)21(27)23(22(28)20(18)26)35-12-4-13-36(29,30)31;/h5-8,17H,4,9-14H2,1-3H3,(H,29,30,31);/q;+1/p-1 |
| InChIKey | NZRLKIPRMPFDRK-UHFFFAOYSA-M |
| XLogP | 2.61 |
| TPSA | 84.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.13 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|