C31H37ClF4O6S2Si — CID 153455945
3-[4-[1-chloro-5-[4-(2-trimethoxysilylethyl)phenyl]-1-(4-tritiophenyl)pentan-3-yl]-2,3,5,6-tetrafluorophenyl]sulfanylpropane-1-sulfonic acid (PubChem CID 153455945) has the molecular formula C31H37ClF4O6S2Si and a molecular weight of 711.30 g/mol. Its IUPAC name is 3-[4-[1-chloro-5-[4-(2-trimethoxysilylethyl)phenyl]-1-(4-tritiophenyl)pentan-3-yl]-2,3,5,6-tetrafluorophenyl]sulfanylpropane-1-sulfonic acid.
| Compound Name | 3-[4-[1-chloro-5-[4-(2-trimethoxysilylethyl)phenyl]-1-(4-tritiophenyl)pentan-3-yl]-2,3,5,6-tetrafluorophenyl]sulfanylpropane-1-sulfonic acid |
|---|---|
| PubChem CID | 153455945 |
| Molecular Formula | C31H37ClF4O6S2Si |
| Molecular Weight | 711.30 g/mol |
| Exact Mass | 710.15 |
| IUPAC Name | 3-[4-[1-chloro-5-[4-(2-trimethoxysilylethyl)phenyl]-1-(4-tritiophenyl)pentan-3-yl]-2,3,5,6-tetrafluorophenyl]sulfanylpropane-1-sulfonic acid |
| SMILES | [3H]c1ccc(C(Cl)CC(CCc2ccc(CC[Si](OC)(OC)OC)cc2)c2c(F)c(F)c(SCCCS(=O)(=O)O)c(F)c2F)cc1 |
| InChI | InChI=1S/C31H37ClF4O6S2Si/c1-40-45(41-2,42-3)19-16-22-12-10-21(11-13-22)14-15-24(20-25(32)23-8-5-4-6-9-23)26-27(33)29(35)31(30(36)28(26)34)43-17-7-18-44(37,38)39/h4-6,8-13,24-25H,7,14-20H2,1-3H3,(H,37,38,39)/i4T |
| InChIKey | ZXJQKAMTJACXJY-IBTRZKOZSA-N |
| XLogP | 8.12 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.30 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|