About 5-bromo-1-(3,5-dimethylphenyl)-6-(4-methylpentan-2-yl)isoquinoline
5-bromo-1-(3,5-dimethylphenyl)-6-(4-methylpentan-2-yl)isoquinoline (PubChem CID 153456900) has the molecular formula C23H26BrN
and a molecular weight of 396.37 g/mol. Its IUPAC name is 5-bromo-1-(3,5-dimethylphenyl)-6-(4-methylpentan-2-yl)isoquinoline.
Molecular Properties
| Compound Name | 5-bromo-1-(3,5-dimethylphenyl)-6-(4-methylpentan-2-yl)isoquinoline |
| PubChem CID | 153456900 |
| Molecular Formula | C23H26BrN |
| Molecular Weight | 396.37 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | 5-bromo-1-(3,5-dimethylphenyl)-6-(4-methylpentan-2-yl)isoquinoline |
| SMILES | Cc1cc(C)cc(-c2nccc3c(Br)c(C(C)CC(C)C)ccc23)c1 |
| InChI | InChI=1S/C23H26BrN/c1-14(2)10-17(5)19-6-7-21-20(22(19)24)8-9-25-23(21)18-12-15(3)11-16(4)13-18/h6-9,11-14,17H,10H2,1-5H3 |
| InChIKey | QPTMPWRKHLAAQT-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.37 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-bromo-1-(3,5-dimethylphenyl)-6-(4-methylpentan-2-yl)isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-1-(3,5-dimethylphenyl)-6-(4-methylpentan-2-yl)isoquinoline?
The IUPAC name of 5-bromo-1-(3,5-dimethylphenyl)-6-(4-methylpentan-2-yl)isoquinoline (CID 153456900) is 5-bromo-1-(3,5-dimethylphenyl)-6-(4-methylpentan-2-yl)isoquinoline.
What is the SMILES notation for 5-bromo-1-(3,5-dimethylphenyl)-6-(4-methylpentan-2-yl)isoquinoline?
The canonical SMILES for 5-bromo-1-(3,5-dimethylphenyl)-6-(4-methylpentan-2-yl)isoquinoline is Cc1cc(C)cc(-c2nccc3c(Br)c(C(C)CC(C)C)ccc23)c1.
What is the InChIKey of 5-bromo-1-(3,5-dimethylphenyl)-6-(4-methylpentan-2-yl)isoquinoline?
The InChIKey is QPTMPWRKHLAAQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H26BrN/c1-14(2)10-17(5)19-6-7-21-20(22(19)24)8-9-25-23(21)18-12-15(3)11-16(4)13-18/h6-9,11-14,17H,10H2,1-5H3.
What are the key properties of 5-bromo-1-(3,5-dimethylphenyl)-6-(4-methylpentan-2-yl)isoquinoline?
5-bromo-1-(3,5-dimethylphenyl)-6-(4-methylpentan-2-yl)isoquinoline has a molecular weight of 396.37 g/mol, XLogP of 7.43, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-1-(3,5-dimethylphenyl)-6-(4-methylpentan-2-yl)isoquinoline is sourced from PubChem (CID 153456900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).