About 5-chloro-7-fluoro-1,4-dihydroquinoxaline-2,3-dione
5-chloro-7-fluoro-1,4-dihydroquinoxaline-2,3-dione (PubChem CID 15345744) has the molecular formula C8H4ClFN2O2
and a molecular weight of 214.58 g/mol. Its IUPAC name is 5-chloro-7-fluoro-1,4-dihydroquinoxaline-2,3-dione.
Molecular Properties
| Compound Name | 5-chloro-7-fluoro-1,4-dihydroquinoxaline-2,3-dione |
| PubChem CID | 15345744 |
| Molecular Formula | C8H4ClFN2O2 |
| Molecular Weight | 214.58 g/mol |
| Exact Mass | 213.99 |
| IUPAC Name | 5-chloro-7-fluoro-1,4-dihydroquinoxaline-2,3-dione |
| SMILES | O=c1[nH]c2cc(F)cc(Cl)c2[nH]c1=O |
| InChI | InChI=1S/C8H4ClFN2O2/c9-4-1-3(10)2-5-6(4)12-8(14)7(13)11-5/h1-2H,(H,11,13)(H,12,14) |
| InChIKey | VSQGBUGZIAQYOV-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.58 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-7-fluoro-1,4-dihydroquinoxaline-2,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-7-fluoro-1,4-dihydroquinoxaline-2,3-dione?
The IUPAC name of 5-chloro-7-fluoro-1,4-dihydroquinoxaline-2,3-dione (CID 15345744) is 5-chloro-7-fluoro-1,4-dihydroquinoxaline-2,3-dione.
What is the SMILES notation for 5-chloro-7-fluoro-1,4-dihydroquinoxaline-2,3-dione?
The canonical SMILES for 5-chloro-7-fluoro-1,4-dihydroquinoxaline-2,3-dione is O=c1[nH]c2cc(F)cc(Cl)c2[nH]c1=O.
What is the InChIKey of 5-chloro-7-fluoro-1,4-dihydroquinoxaline-2,3-dione?
The InChIKey is VSQGBUGZIAQYOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4ClFN2O2/c9-4-1-3(10)2-5-6(4)12-8(14)7(13)11-5/h1-2H,(H,11,13)(H,12,14).
What are the key properties of 5-chloro-7-fluoro-1,4-dihydroquinoxaline-2,3-dione?
5-chloro-7-fluoro-1,4-dihydroquinoxaline-2,3-dione has a molecular weight of 214.58 g/mol, XLogP of 1.01, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-7-fluoro-1,4-dihydroquinoxaline-2,3-dione is sourced from PubChem (CID 15345744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).