About N-(2-aminophenyl)acetamide;2-methanidylpropane;vanadium(2+)
N-(2-aminophenyl)acetamide;2-methanidylpropane;vanadium(2+) (PubChem CID 153457478) has the molecular formula C12H18N2OV
and a molecular weight of 257.23 g/mol. Its IUPAC name is N-(2-aminophenyl)acetamide;2-methanidylpropane;vanadium(2+).
Molecular Properties
| Compound Name | N-(2-aminophenyl)acetamide;2-methanidylpropane;vanadium(2+) |
| PubChem CID | 153457478 |
| Molecular Formula | C12H18N2OV |
| Molecular Weight | 257.23 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | N-(2-aminophenyl)acetamide;2-methanidylpropane;vanadium(2+) |
| SMILES | [CH2-]C(=O)Nc1ccccc1N.[CH2-]C(C)C.[V+2] |
| InChI | InChI=1S/C8H9N2O.C4H9.V/c1-6(11)10-8-5-3-2-4-7(8)9;1-4(2)3;/h2-5H,1,9H2,(H,10,11);4H,1H2,2-3H3;/q2*-1;+2 |
| InChIKey | IQCUPMHWCVBCFI-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.23 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze N-(2-aminophenyl)acetamide;2-methanidylpropane;vanadium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-aminophenyl)acetamide;2-methanidylpropane;vanadium(2+)?
The IUPAC name of N-(2-aminophenyl)acetamide;2-methanidylpropane;vanadium(2+) (CID 153457478) is N-(2-aminophenyl)acetamide;2-methanidylpropane;vanadium(2+).
What is the SMILES notation for N-(2-aminophenyl)acetamide;2-methanidylpropane;vanadium(2+)?
The canonical SMILES for N-(2-aminophenyl)acetamide;2-methanidylpropane;vanadium(2+) is [CH2-]C(=O)Nc1ccccc1N.[CH2-]C(C)C.[V+2].
What is the InChIKey of N-(2-aminophenyl)acetamide;2-methanidylpropane;vanadium(2+)?
The InChIKey is IQCUPMHWCVBCFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N2O.C4H9.V/c1-6(11)10-8-5-3-2-4-7(8)9;1-4(2)3;/h2-5H,1,9H2,(H,10,11);4H,1H2,2-3H3;/q2*-1;+2.
What are the key properties of N-(2-aminophenyl)acetamide;2-methanidylpropane;vanadium(2+)?
N-(2-aminophenyl)acetamide;2-methanidylpropane;vanadium(2+) has a molecular weight of 257.23 g/mol, XLogP of 2.52, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-aminophenyl)acetamide;2-methanidylpropane;vanadium(2+) is sourced from PubChem (CID 153457478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).