C35H43N7O5 — CID 153457483
3-[8-(4-morpholin-4-ylanilino)imidazo[1,2-a]pyrazin-6-yl]-N-[7-(oxan-2-yloxyamino)-7-oxoheptyl]benzamide (PubChem CID 153457483) has the molecular formula C35H43N7O5 and a molecular weight of 641.77 g/mol. Its IUPAC name is 3-[8-(4-morpholin-4-ylanilino)imidazo[1,2-a]pyrazin-6-yl]-N-[7-(oxan-2-yloxyamino)-7-oxoheptyl]benzamide.
| Compound Name | 3-[8-(4-morpholin-4-ylanilino)imidazo[1,2-a]pyrazin-6-yl]-N-[7-(oxan-2-yloxyamino)-7-oxoheptyl]benzamide |
|---|---|
| PubChem CID | 153457483 |
| Molecular Formula | C35H43N7O5 |
| Molecular Weight | 641.77 g/mol |
| Exact Mass | 641.33 |
| IUPAC Name | 3-[8-(4-morpholin-4-ylanilino)imidazo[1,2-a]pyrazin-6-yl]-N-[7-(oxan-2-yloxyamino)-7-oxoheptyl]benzamide |
| SMILES | O=C(CCCCCCNC(=O)c1cccc(-c2cn3ccnc3c(Nc3ccc(N4CCOCC4)cc3)n2)c1)NOC1CCCCO1 |
| InChI | InChI=1S/C35H43N7O5/c43-31(40-47-32-11-4-6-21-46-32)10-3-1-2-5-16-37-35(44)27-9-7-8-26(24-27)30-25-42-18-17-36-34(42)33(39-30)38-28-12-14-29(15-13-28)41-19-22-45-23-20-41/h7-9,12-15,17-18,24-25,32H,1-6,10-11,16,19-23H2,(H,37,44)(H,38,39)(H,40,43) |
| InChIKey | JCEWLSBKRMOLID-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 131.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.77 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|