About 2-[2-chloro-4-(3,5-dimethyl-1,2-oxazol-4-yl)-6-fluoroanilino]benzoic acid
2-[2-chloro-4-(3,5-dimethyl-1,2-oxazol-4-yl)-6-fluoroanilino]benzoic acid (PubChem CID 153457694) has the molecular formula C18H14ClFN2O3
and a molecular weight of 360.77 g/mol. Its IUPAC name is 2-[2-chloro-4-(3,5-dimethyl-1,2-oxazol-4-yl)-6-fluoroanilino]benzoic acid.
Molecular Properties
| Compound Name | 2-[2-chloro-4-(3,5-dimethyl-1,2-oxazol-4-yl)-6-fluoroanilino]benzoic acid |
| PubChem CID | 153457694 |
| Molecular Formula | C18H14ClFN2O3 |
| Molecular Weight | 360.77 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | 2-[2-chloro-4-(3,5-dimethyl-1,2-oxazol-4-yl)-6-fluoroanilino]benzoic acid |
| SMILES | Cc1noc(C)c1-c1cc(F)c(Nc2ccccc2C(=O)O)c(Cl)c1 |
| InChI | InChI=1S/C18H14ClFN2O3/c1-9-16(10(2)25-22-9)11-7-13(19)17(14(20)8-11)21-15-6-4-3-5-12(15)18(23)24/h3-8,21H,1-2H3,(H,23,24) |
| InChIKey | XDWBVKHUGDTIFQ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 360.77 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2-chloro-4-(3,5-dimethyl-1,2-oxazol-4-yl)-6-fluoroanilino]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-chloro-4-(3,5-dimethyl-1,2-oxazol-4-yl)-6-fluoroanilino]benzoic acid?
The IUPAC name of 2-[2-chloro-4-(3,5-dimethyl-1,2-oxazol-4-yl)-6-fluoroanilino]benzoic acid (CID 153457694) is 2-[2-chloro-4-(3,5-dimethyl-1,2-oxazol-4-yl)-6-fluoroanilino]benzoic acid.
What is the SMILES notation for 2-[2-chloro-4-(3,5-dimethyl-1,2-oxazol-4-yl)-6-fluoroanilino]benzoic acid?
The canonical SMILES for 2-[2-chloro-4-(3,5-dimethyl-1,2-oxazol-4-yl)-6-fluoroanilino]benzoic acid is Cc1noc(C)c1-c1cc(F)c(Nc2ccccc2C(=O)O)c(Cl)c1.
What is the InChIKey of 2-[2-chloro-4-(3,5-dimethyl-1,2-oxazol-4-yl)-6-fluoroanilino]benzoic acid?
The InChIKey is XDWBVKHUGDTIFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14ClFN2O3/c1-9-16(10(2)25-22-9)11-7-13(19)17(14(20)8-11)21-15-6-4-3-5-12(15)18(23)24/h3-8,21H,1-2H3,(H,23,24).
What are the key properties of 2-[2-chloro-4-(3,5-dimethyl-1,2-oxazol-4-yl)-6-fluoroanilino]benzoic acid?
2-[2-chloro-4-(3,5-dimethyl-1,2-oxazol-4-yl)-6-fluoroanilino]benzoic acid has a molecular weight of 360.77 g/mol, XLogP of 5.19, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-chloro-4-(3,5-dimethyl-1,2-oxazol-4-yl)-6-fluoroanilino]benzoic acid is sourced from PubChem (CID 153457694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).