C18H15F2N3O3 — CID 153457699
2-[4-(3,5-dimethyl-1,2-oxazol-4-yl)-2,6-difluoroanilino]-N-hydroxybenzamide (PubChem CID 153457699) has the molecular formula C18H15F2N3O3 and a molecular weight of 359.33 g/mol. Its IUPAC name is 2-[4-(3,5-dimethyl-1,2-oxazol-4-yl)-2,6-difluoroanilino]-N-hydroxybenzamide.
| Compound Name | 2-[4-(3,5-dimethyl-1,2-oxazol-4-yl)-2,6-difluoroanilino]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 153457699 |
| Molecular Formula | C18H15F2N3O3 |
| Molecular Weight | 359.33 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | 2-[4-(3,5-dimethyl-1,2-oxazol-4-yl)-2,6-difluoroanilino]-N-hydroxybenzamide |
| SMILES | Cc1noc(C)c1-c1cc(F)c(Nc2ccccc2C(=O)NO)c(F)c1 |
| InChI | InChI=1S/C18H15F2N3O3/c1-9-16(10(2)26-23-9)11-7-13(19)17(14(20)8-11)21-15-6-4-3-5-12(15)18(24)22-25/h3-8,21,25H,1-2H3,(H,22,24) |
| InChIKey | ZFOCSLZFJSBKCE-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.33 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|