C65H43N5O — CID 153458193
5-[2-[3,5-bis[2-(1-phenylpyrazol-4-yl)phenyl]phenyl]phenyl]-2-(3-dibenzofuran-3-ylphenyl)pyridine (PubChem CID 153458193) has the molecular formula C65H43N5O and a molecular weight of 910.09 g/mol. Its IUPAC name is 5-[2-[3,5-bis[2-(1-phenylpyrazol-4-yl)phenyl]phenyl]phenyl]-2-(3-dibenzofuran-3-ylphenyl)pyridine.
| Compound Name | 5-[2-[3,5-bis[2-(1-phenylpyrazol-4-yl)phenyl]phenyl]phenyl]-2-(3-dibenzofuran-3-ylphenyl)pyridine |
|---|---|
| PubChem CID | 153458193 |
| Molecular Formula | C65H43N5O |
| Molecular Weight | 910.09 g/mol |
| Exact Mass | 909.35 |
| IUPAC Name | 5-[2-[3,5-bis[2-(1-phenylpyrazol-4-yl)phenyl]phenyl]phenyl]-2-(3-dibenzofuran-3-ylphenyl)pyridine |
| SMILES | c1ccc(-n2cc(-c3ccccc3-c3cc(-c4ccccc4-c4ccc(-c5cccc(-c6ccc7c(c6)oc6ccccc67)c5)nc4)cc(-c4ccccc4-c4cnn(-c5ccccc5)c4)c3)cn2)cc1 |
| InChI | InChI=1S/C65H43N5O/c1-3-18-53(19-4-1)69-42-51(40-67-69)59-26-11-9-24-57(59)49-35-48(36-50(37-49)58-25-10-12-27-60(58)52-41-68-70(43-52)54-20-5-2-6-21-54)56-23-8-7-22-55(56)47-31-33-63(66-39-47)46-17-15-16-44(34-46)45-30-32-62-61-28-13-14-29-64(61)71-65(62)38-45/h1-43H |
| InChIKey | QGWZKNOBHPAAAE-UHFFFAOYSA-N |
| XLogP | 16.69 |
| TPSA | 61.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 910.09 |
| LogP ≤ 5 | 16.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |