C69H45F2N3 — CID 153458373
2-[4-[2-[3,5-bis[5-fluoro-2-(4-pyridin-2-ylphenyl)phenyl]phenyl]phenyl]-3-(4-phenylphenyl)phenyl]pyridine (PubChem CID 153458373) has the molecular formula C69H45F2N3 and a molecular weight of 954.14 g/mol. Its IUPAC name is 2-[4-[2-[3,5-bis[5-fluoro-2-(4-pyridin-2-ylphenyl)phenyl]phenyl]phenyl]-3-(4-phenylphenyl)phenyl]pyridine.
| Compound Name | 2-[4-[2-[3,5-bis[5-fluoro-2-(4-pyridin-2-ylphenyl)phenyl]phenyl]phenyl]-3-(4-phenylphenyl)phenyl]pyridine |
|---|---|
| PubChem CID | 153458373 |
| Molecular Formula | C69H45F2N3 |
| Molecular Weight | 954.14 g/mol |
| Exact Mass | 953.36 |
| IUPAC Name | 2-[4-[2-[3,5-bis[5-fluoro-2-(4-pyridin-2-ylphenyl)phenyl]phenyl]phenyl]-3-(4-phenylphenyl)phenyl]pyridine |
| SMILES | Fc1ccc(-c2ccc(-c3ccccn3)cc2)c(-c2cc(-c3cc(F)ccc3-c3ccc(-c4ccccn4)cc3)cc(-c3ccccc3-c3ccc(-c4ccccn4)cc3-c3ccc(-c4ccccc4)cc3)c2)c1 |
| InChI | InChI=1S/C69H45F2N3/c70-57-32-35-60(48-23-27-51(28-24-48)67-16-6-9-37-72-67)65(44-57)55-40-54(41-56(42-55)66-45-58(71)33-36-61(66)49-25-29-52(30-26-49)68-17-7-10-38-73-68)59-14-4-5-15-62(59)63-34-31-53(69-18-8-11-39-74-69)43-64(63)50-21-19-47(20-22-50)46-12-2-1-3-13-46/h1-45H |
| InChIKey | RESFDKNLESCNQQ-UHFFFAOYSA-N |
| XLogP | 18.49 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 954.14 |
| LogP ≤ 5 | 18.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |