About 6-bromo-2,4-ditert-butylquinoline
6-bromo-2,4-ditert-butylquinoline (PubChem CID 153459061) has the molecular formula C17H22BrN
and a molecular weight of 320.27 g/mol. Its IUPAC name is 6-bromo-2,4-ditert-butylquinoline.
Molecular Properties
| Compound Name | 6-bromo-2,4-ditert-butylquinoline |
| PubChem CID | 153459061 |
| Molecular Formula | C17H22BrN |
| Molecular Weight | 320.27 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | 6-bromo-2,4-ditert-butylquinoline |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c2cc(Br)ccc2n1 |
| InChI | InChI=1S/C17H22BrN/c1-16(2,3)13-10-15(17(4,5)6)19-14-8-7-11(18)9-12(13)14/h7-10H,1-6H3 |
| InChIKey | XISDQBQWHFPYKW-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 320.27 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-bromo-2,4-ditert-butylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-2,4-ditert-butylquinoline?
The IUPAC name of 6-bromo-2,4-ditert-butylquinoline (CID 153459061) is 6-bromo-2,4-ditert-butylquinoline.
What is the SMILES notation for 6-bromo-2,4-ditert-butylquinoline?
The canonical SMILES for 6-bromo-2,4-ditert-butylquinoline is CC(C)(C)c1cc(C(C)(C)C)c2cc(Br)ccc2n1.
What is the InChIKey of 6-bromo-2,4-ditert-butylquinoline?
The InChIKey is XISDQBQWHFPYKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22BrN/c1-16(2,3)13-10-15(17(4,5)6)19-14-8-7-11(18)9-12(13)14/h7-10H,1-6H3.
What are the key properties of 6-bromo-2,4-ditert-butylquinoline?
6-bromo-2,4-ditert-butylquinoline has a molecular weight of 320.27 g/mol, XLogP of 5.59, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-2,4-ditert-butylquinoline is sourced from PubChem (CID 153459061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).