C22H33N3 — CID 153459065
2,4-ditert-butyl-8-(4-methylpiperazin-1-yl)quinoline (PubChem CID 153459065) has the molecular formula C22H33N3 and a molecular weight of 339.53 g/mol. Its IUPAC name is 2,4-ditert-butyl-8-(4-methylpiperazin-1-yl)quinoline.
| Compound Name | 2,4-ditert-butyl-8-(4-methylpiperazin-1-yl)quinoline |
|---|---|
| PubChem CID | 153459065 |
| Molecular Formula | C22H33N3 |
| Molecular Weight | 339.53 g/mol |
| Exact Mass | 339.27 |
| IUPAC Name | 2,4-ditert-butyl-8-(4-methylpiperazin-1-yl)quinoline |
| SMILES | CN1CCN(c2cccc3c(C(C)(C)C)cc(C(C)(C)C)nc23)CC1 |
| InChI | InChI=1S/C22H33N3/c1-21(2,3)17-15-19(22(4,5)6)23-20-16(17)9-8-10-18(20)25-13-11-24(7)12-14-25/h8-10,15H,11-14H2,1-7H3 |
| InChIKey | OTRLWNOJCIOKIG-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.53 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |