C63H40N4O — CID 153459949
3-[4-(2,5-diphenylphenyl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-11-phenyl-[1]benzofuro[3,2-b]carbazole (PubChem CID 153459949) has the molecular formula C63H40N4O and a molecular weight of 869.04 g/mol. Its IUPAC name is 3-[4-(2,5-diphenylphenyl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-11-phenyl-[1]benzofuro[3,2-b]carbazole.
| Compound Name | 3-[4-(2,5-diphenylphenyl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-11-phenyl-[1]benzofuro[3,2-b]carbazole |
|---|---|
| PubChem CID | 153459949 |
| Molecular Formula | C63H40N4O |
| Molecular Weight | 869.04 g/mol |
| Exact Mass | 868.32 |
| IUPAC Name | 3-[4-(2,5-diphenylphenyl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-11-phenyl-[1]benzofuro[3,2-b]carbazole |
| SMILES | c1ccc(-c2ccc(-c3ccccc3)c(-c3ccc(-c4ccc5c(c4)oc4cc6c7ccccc7n(-c7ccccc7)c6cc45)c(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3)c2)cc1 |
| InChI | InChI=1S/C63H40N4O/c1-6-18-41(19-7-1)45-30-33-49(42-20-8-2-9-21-42)53(36-45)46-31-34-50(56(37-46)63-65-61(43-22-10-3-11-23-43)64-62(66-63)44-24-12-4-13-25-44)47-32-35-52-55-39-58-54(40-60(55)68-59(52)38-47)51-28-16-17-29-57(51)67(58)48-26-14-5-15-27-48/h1-40H |
| InChIKey | CTFMWDUKYBGSAZ-UHFFFAOYSA-N |
| XLogP | 16.54 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 869.04 |
| LogP ≤ 5 | 16.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |