C13H18N10 — CID 15346036
6-[5-(4,6-diamino-1,3,5-triazin-2-yl)-2-bicyclo[2.2.1]heptanyl]-1,3,5-triazine-2,4-diamine (PubChem CID 15346036) has the molecular formula C13H18N10 and a molecular weight of 314.36 g/mol. Its IUPAC name is 6-[5-(4,6-diamino-1,3,5-triazin-2-yl)-2-bicyclo[2.2.1]heptanyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[5-(4,6-diamino-1,3,5-triazin-2-yl)-2-bicyclo[2.2.1]heptanyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 15346036 |
| Molecular Formula | C13H18N10 |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 6-[5-(4,6-diamino-1,3,5-triazin-2-yl)-2-bicyclo[2.2.1]heptanyl]-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1nc(N)nc(C2CC3CC2CC3c2nc(N)nc(N)n2)n1 |
| InChI | InChI=1S/C13H18N10/c14-10-18-8(19-11(15)22-10)6-2-4-1-5(6)3-7(4)9-20-12(16)23-13(17)21-9/h4-7H,1-3H2,(H4,14,15,18,19,22)(H4,16,17,20,21,23) |
| InChIKey | BKYMOFKAHRQJNT-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 181.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |