C21H17FN4O3 — CID 15346068
2-[6-fluoro-3-(2-methoxyphenyl)benzotriazol-5-yl]-4,5,6,7-tetrahydroisoindole-1,3-dione (PubChem CID 15346068) has the molecular formula C21H17FN4O3 and a molecular weight of 392.39 g/mol. Its IUPAC name is 2-[6-fluoro-3-(2-methoxyphenyl)benzotriazol-5-yl]-4,5,6,7-tetrahydroisoindole-1,3-dione.
| Compound Name | 2-[6-fluoro-3-(2-methoxyphenyl)benzotriazol-5-yl]-4,5,6,7-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 15346068 |
| Molecular Formula | C21H17FN4O3 |
| Molecular Weight | 392.39 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | 2-[6-fluoro-3-(2-methoxyphenyl)benzotriazol-5-yl]-4,5,6,7-tetrahydroisoindole-1,3-dione |
| SMILES | COc1ccccc1-n1nnc2cc(F)c(N3C(=O)C4=C(CCCC4)C3=O)cc21 |
| InChI | InChI=1S/C21H17FN4O3/c1-29-19-9-5-4-8-16(19)26-18-11-17(14(22)10-15(18)23-24-26)25-20(27)12-6-2-3-7-13(12)21(25)28/h4-5,8-11H,2-3,6-7H2,1H3 |
| InChIKey | RDDVPABKHWFHKV-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.39 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|