C19H19N3O3 — CID 15346096
(E)-1-[2-[(2,5-dimethylphenoxy)methyl]phenyl]-N-methoxy-1-(1,2,4-oxadiazol-3-yl)methanimine (PubChem CID 15346096) has the molecular formula C19H19N3O3 and a molecular weight of 337.38 g/mol. Its IUPAC name is (E)-1-[2-[(2,5-dimethylphenoxy)methyl]phenyl]-N-methoxy-1-(1,2,4-oxadiazol-3-yl)methanimine.
| Compound Name | (E)-1-[2-[(2,5-dimethylphenoxy)methyl]phenyl]-N-methoxy-1-(1,2,4-oxadiazol-3-yl)methanimine |
|---|---|
| PubChem CID | 15346096 |
| Molecular Formula | C19H19N3O3 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | (E)-1-[2-[(2,5-dimethylphenoxy)methyl]phenyl]-N-methoxy-1-(1,2,4-oxadiazol-3-yl)methanimine |
| SMILES | CO/N=C(/c1ncon1)c1ccccc1COc1cc(C)ccc1C |
| InChI | InChI=1S/C19H19N3O3/c1-13-8-9-14(2)17(10-13)24-11-15-6-4-5-7-16(15)18(21-23-3)19-20-12-25-22-19/h4-10,12H,11H2,1-3H3/b21-18+ |
| InChIKey | KMEDMWWQAAMEIR-DYTRJAOYSA-N |
| XLogP | 3.66 |
| TPSA | 69.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|