About 2-(2,4-dimethylphenyl)-1,4-dimethyl-5-(2-methylpropyl)pyridin-1-ium
2-(2,4-dimethylphenyl)-1,4-dimethyl-5-(2-methylpropyl)pyridin-1-ium (PubChem CID 153461119) has the molecular formula C19H26N+
and a molecular weight of 268.42 g/mol. Its IUPAC name is 2-(2,4-dimethylphenyl)-1,4-dimethyl-5-(2-methylpropyl)pyridin-1-ium.
Molecular Properties
| Compound Name | 2-(2,4-dimethylphenyl)-1,4-dimethyl-5-(2-methylpropyl)pyridin-1-ium |
| PubChem CID | 153461119 |
| Molecular Formula | C19H26N+ |
| Molecular Weight | 268.42 g/mol |
| Exact Mass | 268.21 |
| IUPAC Name | 2-(2,4-dimethylphenyl)-1,4-dimethyl-5-(2-methylpropyl)pyridin-1-ium |
| SMILES | Cc1ccc(-c2cc(C)c(CC(C)C)c[n+]2C)c(C)c1 |
| InChI | InChI=1S/C19H26N/c1-13(2)9-17-12-20(6)19(11-15(17)4)18-8-7-14(3)10-16(18)5/h7-8,10-13H,9H2,1-6H3/q+1 |
| InChIKey | UQERSKMKKRYPED-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.42 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,4-dimethylphenyl)-1,4-dimethyl-5-(2-methylpropyl)pyridin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4-dimethylphenyl)-1,4-dimethyl-5-(2-methylpropyl)pyridin-1-ium?
The IUPAC name of 2-(2,4-dimethylphenyl)-1,4-dimethyl-5-(2-methylpropyl)pyridin-1-ium (CID 153461119) is 2-(2,4-dimethylphenyl)-1,4-dimethyl-5-(2-methylpropyl)pyridin-1-ium.
What is the SMILES notation for 2-(2,4-dimethylphenyl)-1,4-dimethyl-5-(2-methylpropyl)pyridin-1-ium?
The canonical SMILES for 2-(2,4-dimethylphenyl)-1,4-dimethyl-5-(2-methylpropyl)pyridin-1-ium is Cc1ccc(-c2cc(C)c(CC(C)C)c[n+]2C)c(C)c1.
What is the InChIKey of 2-(2,4-dimethylphenyl)-1,4-dimethyl-5-(2-methylpropyl)pyridin-1-ium?
The InChIKey is UQERSKMKKRYPED-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26N/c1-13(2)9-17-12-20(6)19(11-15(17)4)18-8-7-14(3)10-16(18)5/h7-8,10-13H,9H2,1-6H3/q+1.
What are the key properties of 2-(2,4-dimethylphenyl)-1,4-dimethyl-5-(2-methylpropyl)pyridin-1-ium?
2-(2,4-dimethylphenyl)-1,4-dimethyl-5-(2-methylpropyl)pyridin-1-ium has a molecular weight of 268.42 g/mol, XLogP of 4.30, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-dimethylphenyl)-1,4-dimethyl-5-(2-methylpropyl)pyridin-1-ium is sourced from PubChem (CID 153461119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).