C56H30N4S2 — CID 153461940
4-isocyano-2,5-bis(10-phenyl-[1]benzothiolo[2,3-b]carbazol-7-yl)benzonitrile (PubChem CID 153461940) has the molecular formula C56H30N4S2 and a molecular weight of 823.02 g/mol. Its IUPAC name is 4-isocyano-2,5-bis(10-phenyl-[1]benzothiolo[2,3-b]carbazol-7-yl)benzonitrile.
| Compound Name | 4-isocyano-2,5-bis(10-phenyl-[1]benzothiolo[2,3-b]carbazol-7-yl)benzonitrile |
|---|---|
| PubChem CID | 153461940 |
| Molecular Formula | C56H30N4S2 |
| Molecular Weight | 823.02 g/mol |
| Exact Mass | 822.19 |
| IUPAC Name | 4-isocyano-2,5-bis(10-phenyl-[1]benzothiolo[2,3-b]carbazol-7-yl)benzonitrile |
| SMILES | [C-]#[N+]c1cc(-n2c3ccc(-c4ccccc4)cc3c3cc4c(cc32)sc2ccccc24)c(C#N)cc1-n1c2ccc(-c3ccccc3)cc2c2cc3c(cc21)sc1ccccc13 |
| InChI | InChI=1S/C56H30N4S2/c1-58-46-29-49(59-47-22-20-35(33-12-4-2-5-13-33)24-40(47)42-27-44-38-16-8-10-18-53(38)61-55(44)30-50(42)59)37(32-57)26-52(46)60-48-23-21-36(34-14-6-3-7-15-34)25-41(48)43-28-45-39-17-9-11-19-54(39)62-56(45)31-51(43)60/h2-31H |
| InChIKey | YYQLVSIZPAZIKC-UHFFFAOYSA-N |
| XLogP | 16.37 |
| TPSA | 38.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.02 |
| LogP ≤ 5 | 16.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|