C38H20N4O — CID 153462215
2-isocyano-5-(24-phenyl-15-oxa-6,24-diazaheptacyclo[14.11.0.02,14.05,13.07,12.017,25.018,23]heptacosa-1(16),2(14),3,5(13),7,9,11,17(25),18,20,22,26-dodecaen-6-yl)benzonitrile (PubChem CID 153462215) has the molecular formula C38H20N4O and a molecular weight of 548.61 g/mol. Its IUPAC name is 2-isocyano-5-(24-phenyl-15-oxa-6,24-diazaheptacyclo[14.11.0.02,14.05,13.07,12.017,25.018,23]heptacosa-1(16),2(14),3,5(13),7,9,11,17(25),18,20,22,26-dodecaen-6-yl)benzonitrile.
| Compound Name | 2-isocyano-5-(24-phenyl-15-oxa-6,24-diazaheptacyclo[14.11.0.02,14.05,13.07,12.017,25.018,23]heptacosa-1(16),2(14),3,5(13),7,9,11,17(25),18,20,22,26-dodecaen-6-yl)benzonitrile |
|---|---|
| PubChem CID | 153462215 |
| Molecular Formula | C38H20N4O |
| Molecular Weight | 548.61 g/mol |
| Exact Mass | 548.16 |
| IUPAC Name | 2-isocyano-5-(24-phenyl-15-oxa-6,24-diazaheptacyclo[14.11.0.02,14.05,13.07,12.017,25.018,23]heptacosa-1(16),2(14),3,5(13),7,9,11,17(25),18,20,22,26-dodecaen-6-yl)benzonitrile |
| SMILES | [C-]#[N+]c1ccc(-n2c3ccccc3c3c4oc5c(ccc6c5c5ccccc5n6-c5ccccc5)c4ccc32)cc1C#N |
| InChI | InChI=1S/C38H20N4O/c1-40-30-18-15-25(21-23(30)22-39)42-32-14-8-6-12-29(32)36-34(42)20-17-27-26-16-19-33-35(37(26)43-38(27)36)28-11-5-7-13-31(28)41(33)24-9-3-2-4-10-24/h2-21H |
| InChIKey | GZNSBNLBFDVOQY-UHFFFAOYSA-N |
| XLogP | 10.20 |
| TPSA | 51.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.61 |
| LogP ≤ 5 | 10.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|