C38H22N4O — CID 153462261
5-isocyano-2-[2-(N-phenylanilino)-[1]benzofuro[3,2-c]carbazol-5-yl]benzonitrile (PubChem CID 153462261) has the molecular formula C38H22N4O and a molecular weight of 550.62 g/mol. Its IUPAC name is 5-isocyano-2-[2-(N-phenylanilino)-[1]benzofuro[3,2-c]carbazol-5-yl]benzonitrile.
| Compound Name | 5-isocyano-2-[2-(N-phenylanilino)-[1]benzofuro[3,2-c]carbazol-5-yl]benzonitrile |
|---|---|
| PubChem CID | 153462261 |
| Molecular Formula | C38H22N4O |
| Molecular Weight | 550.62 g/mol |
| Exact Mass | 550.18 |
| IUPAC Name | 5-isocyano-2-[2-(N-phenylanilino)-[1]benzofuro[3,2-c]carbazol-5-yl]benzonitrile |
| SMILES | [C-]#[N+]c1ccc(-n2c3ccc(N(c4ccccc4)c4ccccc4)cc3c3c4oc5ccccc5c4ccc32)c(C#N)c1 |
| InChI | InChI=1S/C38H22N4O/c1-40-26-16-19-33(25(22-26)24-39)42-34-20-17-29(41(27-10-4-2-5-11-27)28-12-6-3-7-13-28)23-32(34)37-35(42)21-18-31-30-14-8-9-15-36(30)43-38(31)37/h2-23H |
| InChIKey | JTVUMTRZYAEASK-UHFFFAOYSA-N |
| XLogP | 10.58 |
| TPSA | 49.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.62 |
| LogP ≤ 5 | 10.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|