About 3,4,4-trifluorobut-3-enyl N-(benzhydrylideneamino)carbamodithioate
3,4,4-trifluorobut-3-enyl N-(benzhydrylideneamino)carbamodithioate (PubChem CID 15346240) has the molecular formula C18H15F3N2S2
and a molecular weight of 380.46 g/mol. Its IUPAC name is 3,4,4-trifluorobut-3-enyl N-(benzhydrylideneamino)carbamodithioate.
Molecular Properties
| Compound Name | 3,4,4-trifluorobut-3-enyl N-(benzhydrylideneamino)carbamodithioate |
| PubChem CID | 15346240 |
| Molecular Formula | C18H15F3N2S2 |
| Molecular Weight | 380.46 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | 3,4,4-trifluorobut-3-enyl N-(benzhydrylideneamino)carbamodithioate |
| SMILES | FC(F)=C(F)CCSC(=S)NN=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H15F3N2S2/c19-15(17(20)21)11-12-25-18(24)23-22-16(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10H,11-12H2,(H,23,24) |
| InChIKey | KFIDNHDUDQKQJX-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.46 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3,4,4-trifluorobut-3-enyl N-(benzhydrylideneamino)carbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4,4-trifluorobut-3-enyl N-(benzhydrylideneamino)carbamodithioate?
The IUPAC name of 3,4,4-trifluorobut-3-enyl N-(benzhydrylideneamino)carbamodithioate (CID 15346240) is 3,4,4-trifluorobut-3-enyl N-(benzhydrylideneamino)carbamodithioate.
What is the SMILES notation for 3,4,4-trifluorobut-3-enyl N-(benzhydrylideneamino)carbamodithioate?
The canonical SMILES for 3,4,4-trifluorobut-3-enyl N-(benzhydrylideneamino)carbamodithioate is FC(F)=C(F)CCSC(=S)NN=C(c1ccccc1)c1ccccc1.
What is the InChIKey of 3,4,4-trifluorobut-3-enyl N-(benzhydrylideneamino)carbamodithioate?
The InChIKey is KFIDNHDUDQKQJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15F3N2S2/c19-15(17(20)21)11-12-25-18(24)23-22-16(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10H,11-12H2,(H,23,24).
What are the key properties of 3,4,4-trifluorobut-3-enyl N-(benzhydrylideneamino)carbamodithioate?
3,4,4-trifluorobut-3-enyl N-(benzhydrylideneamino)carbamodithioate has a molecular weight of 380.46 g/mol, XLogP of 5.51, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4,4-trifluorobut-3-enyl N-(benzhydrylideneamino)carbamodithioate is sourced from PubChem (CID 15346240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).