C36H19N3O — CID 153462513
2-(10-dibenzofuran-3-ylbenzo[c]carbazol-7-yl)-4-isocyanobenzonitrile (PubChem CID 153462513) has the molecular formula C36H19N3O and a molecular weight of 509.57 g/mol. Its IUPAC name is 2-(10-dibenzofuran-3-ylbenzo[c]carbazol-7-yl)-4-isocyanobenzonitrile.
| Compound Name | 2-(10-dibenzofuran-3-ylbenzo[c]carbazol-7-yl)-4-isocyanobenzonitrile |
|---|---|
| PubChem CID | 153462513 |
| Molecular Formula | C36H19N3O |
| Molecular Weight | 509.57 g/mol |
| Exact Mass | 509.15 |
| IUPAC Name | 2-(10-dibenzofuran-3-ylbenzo[c]carbazol-7-yl)-4-isocyanobenzonitrile |
| SMILES | [C-]#[N+]c1ccc(C#N)c(-n2c3ccc(-c4ccc5c(c4)oc4ccccc45)cc3c3c4ccccc4ccc32)c1 |
| InChI | InChI=1S/C36H19N3O/c1-38-26-14-10-25(21-37)33(20-26)39-31-16-13-23(18-30(31)36-27-7-3-2-6-22(27)12-17-32(36)39)24-11-15-29-28-8-4-5-9-34(28)40-35(29)19-24/h2-20H |
| InChIKey | QNEKJKUNJLLSHG-UHFFFAOYSA-N |
| XLogP | 9.93 |
| TPSA | 46.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.57 |
| LogP ≤ 5 | 9.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|