About diphenyl-bis[3-([1,3]thiazolo[3,2-a]benzimidazol-7-yl)phenyl]silane
diphenyl-bis[3-([1,3]thiazolo[3,2-a]benzimidazol-7-yl)phenyl]silane (PubChem CID 153462959) has the molecular formula C42H28N4S2Si
and a molecular weight of 680.93 g/mol. Its IUPAC name is diphenyl-bis[3-([1,3]thiazolo[3,2-a]benzimidazol-7-yl)phenyl]silane.
Molecular Properties
| Compound Name | diphenyl-bis[3-([1,3]thiazolo[3,2-a]benzimidazol-7-yl)phenyl]silane |
| PubChem CID | 153462959 |
| Molecular Formula | C42H28N4S2Si |
| Molecular Weight | 680.93 g/mol |
| Exact Mass | 680.15 |
| IUPAC Name | diphenyl-bis[3-([1,3]thiazolo[3,2-a]benzimidazol-7-yl)phenyl]silane |
| SMILES | c1ccc([Si](c2ccccc2)(c2cccc(-c3ccc4nc5sccn5c4c3)c2)c2cccc(-c3ccc4nc5sccn5c4c3)c2)cc1 |
| InChI | InChI=1S/C42H28N4S2Si/c1-3-11-33(12-4-1)49(34-13-5-2-6-14-34,35-15-7-9-29(25-35)31-17-19-37-39(27-31)45-21-23-47-41(45)43-37)36-16-8-10-30(26-36)32-18-20-38-40(28-32)46-22-24-48-42(46)44-38/h1-28H |
| InChIKey | VINPRPHKLRVQKZ-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 34.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 680.93 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze diphenyl-bis[3-([1,3]thiazolo[3,2-a]benzimidazol-7-yl)phenyl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenyl-bis[3-([1,3]thiazolo[3,2-a]benzimidazol-7-yl)phenyl]silane?
The IUPAC name of diphenyl-bis[3-([1,3]thiazolo[3,2-a]benzimidazol-7-yl)phenyl]silane (CID 153462959) is diphenyl-bis[3-([1,3]thiazolo[3,2-a]benzimidazol-7-yl)phenyl]silane.
What is the SMILES notation for diphenyl-bis[3-([1,3]thiazolo[3,2-a]benzimidazol-7-yl)phenyl]silane?
The canonical SMILES for diphenyl-bis[3-([1,3]thiazolo[3,2-a]benzimidazol-7-yl)phenyl]silane is c1ccc([Si](c2ccccc2)(c2cccc(-c3ccc4nc5sccn5c4c3)c2)c2cccc(-c3ccc4nc5sccn5c4c3)c2)cc1.
What is the InChIKey of diphenyl-bis[3-([1,3]thiazolo[3,2-a]benzimidazol-7-yl)phenyl]silane?
The InChIKey is VINPRPHKLRVQKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C42H28N4S2Si/c1-3-11-33(12-4-1)49(34-13-5-2-6-14-34,35-15-7-9-29(25-35)31-17-19-37-39(27-31)45-21-23-47-41(45)43-37)36-16-8-10-30(26-36)32-18-20-38-40(28-32)46-22-24-48-42(46)44-38/h1-28H.
What are the key properties of diphenyl-bis[3-([1,3]thiazolo[3,2-a]benzimidazol-7-yl)phenyl]silane?
diphenyl-bis[3-([1,3]thiazolo[3,2-a]benzimidazol-7-yl)phenyl]silane has a molecular weight of 680.93 g/mol, XLogP of 8.12, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for diphenyl-bis[3-([1,3]thiazolo[3,2-a]benzimidazol-7-yl)phenyl]silane is sourced from PubChem (CID 153462959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).