C30H38IrNO2- — CID 153463281
3-(3-ethyl-5-methylbenzene-6-id-1-yl)isoquinoline;(Z)-5-hydroxy-2,2,6,6-tetramethyloct-4-en-3-one;iridium (PubChem CID 153463281) has the molecular formula C30H38IrNO2- and a molecular weight of 636.86 g/mol. Its IUPAC name is 3-(3-ethyl-5-methylbenzene-6-id-1-yl)isoquinoline;(Z)-5-hydroxy-2,2,6,6-tetramethyloct-4-en-3-one;iridium.
| Compound Name | 3-(3-ethyl-5-methylbenzene-6-id-1-yl)isoquinoline;(Z)-5-hydroxy-2,2,6,6-tetramethyloct-4-en-3-one;iridium |
|---|---|
| PubChem CID | 153463281 |
| Molecular Formula | C30H38IrNO2- |
| Molecular Weight | 636.86 g/mol |
| Exact Mass | 637.25 |
| IUPAC Name | 3-(3-ethyl-5-methylbenzene-6-id-1-yl)isoquinoline;(Z)-5-hydroxy-2,2,6,6-tetramethyloct-4-en-3-one;iridium |
| SMILES | CCC(C)(C)/C(O)=C/C(=O)C(C)(C)C.CCc1cc(C)[c-]c(-c2cc3ccccc3cn2)c1.[Ir] |
| InChI | InChI=1S/C18H16N.C12H22O2.Ir/c1-3-14-8-13(2)9-17(10-14)18-11-15-6-4-5-7-16(15)12-19-18;1-7-12(5,6)10(14)8-9(13)11(2,3)4;/h4-8,10-12H,3H2,1-2H3;8,14H,7H2,1-6H3;/q-1;;/b;10-8-; |
| InChIKey | QAHPZMMZMYLVDS-VINONVIGSA-N |
| XLogP | 8.05 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.86 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|