C32H26I3O4S+ — CID 153464108
diphenyl-[4-[2-(2,3,6-triiodobenzoyl)oxycyclohexanecarbonyl]oxyphenyl]sulfanium (PubChem CID 153464108) has the molecular formula C32H26I3O4S+ and a molecular weight of 887.33 g/mol. Its IUPAC name is diphenyl-[4-[2-(2,3,6-triiodobenzoyl)oxycyclohexanecarbonyl]oxyphenyl]sulfanium.
| Compound Name | diphenyl-[4-[2-(2,3,6-triiodobenzoyl)oxycyclohexanecarbonyl]oxyphenyl]sulfanium |
|---|---|
| PubChem CID | 153464108 |
| Molecular Formula | C32H26I3O4S+ |
| Molecular Weight | 887.33 g/mol |
| Exact Mass | 886.87 |
| IUPAC Name | diphenyl-[4-[2-(2,3,6-triiodobenzoyl)oxycyclohexanecarbonyl]oxyphenyl]sulfanium |
| SMILES | O=C(OC1CCCCC1C(=O)Oc1ccc([S+](c2ccccc2)c2ccccc2)cc1)c1c(I)ccc(I)c1I |
| InChI | InChI=1S/C32H26I3O4S/c33-26-19-20-27(34)30(35)29(26)32(37)39-28-14-8-7-13-25(28)31(36)38-21-15-17-24(18-16-21)40(22-9-3-1-4-10-22)23-11-5-2-6-12-23/h1-6,9-12,15-20,25,28H,7-8,13-14H2/q+1 |
| InChIKey | VVTQQJCMEWUENF-UHFFFAOYSA-N |
| XLogP | 8.92 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 887.33 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|