C23H17F2N2O+ — CID 153464314
2-(1,7-difluoro-3-methyldibenzofuran-4-yl)-1-methyl-3-phenylimidazol-1-ium (PubChem CID 153464314) has the molecular formula C23H17F2N2O+ and a molecular weight of 375.40 g/mol. Its IUPAC name is 2-(1,7-difluoro-3-methyldibenzofuran-4-yl)-1-methyl-3-phenylimidazol-1-ium.
| Compound Name | 2-(1,7-difluoro-3-methyldibenzofuran-4-yl)-1-methyl-3-phenylimidazol-1-ium |
|---|---|
| PubChem CID | 153464314 |
| Molecular Formula | C23H17F2N2O+ |
| Molecular Weight | 375.40 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 2-(1,7-difluoro-3-methyldibenzofuran-4-yl)-1-methyl-3-phenylimidazol-1-ium |
| SMILES | Cc1cc(F)c2c(oc3cc(F)ccc32)c1-c1n(-c2ccccc2)cc[n+]1C |
| InChI | InChI=1S/C23H17F2N2O/c1-14-12-18(25)21-17-9-8-15(24)13-19(17)28-22(21)20(14)23-26(2)10-11-27(23)16-6-4-3-5-7-16/h3-13H,1-2H3/q+1 |
| InChIKey | JSOSIANGSWLBLV-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 21.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.40 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|