C26H22F2NO+ — CID 153464320
2-(5,11-difluoro-9-methylnaphtho[2,1-b][1]benzofuran-8-yl)-1-methyl-4-propan-2-ylpyridin-1-ium (PubChem CID 153464320) has the molecular formula C26H22F2NO+ and a molecular weight of 402.46 g/mol. Its IUPAC name is 2-(5,11-difluoro-9-methylnaphtho[2,1-b][1]benzofuran-8-yl)-1-methyl-4-propan-2-ylpyridin-1-ium.
| Compound Name | 2-(5,11-difluoro-9-methylnaphtho[2,1-b][1]benzofuran-8-yl)-1-methyl-4-propan-2-ylpyridin-1-ium |
|---|---|
| PubChem CID | 153464320 |
| Molecular Formula | C26H22F2NO+ |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 2-(5,11-difluoro-9-methylnaphtho[2,1-b][1]benzofuran-8-yl)-1-methyl-4-propan-2-ylpyridin-1-ium |
| SMILES | Cc1cc(F)c2c(oc3cc(F)c4ccccc4c32)c1-c1cc(C(C)C)cc[n+]1C |
| InChI | InChI=1S/C26H22F2NO/c1-14(2)16-9-10-29(4)21(12-16)23-15(3)11-20(28)25-24-18-8-6-5-7-17(18)19(27)13-22(24)30-26(23)25/h5-14H,1-4H3/q+1 |
| InChIKey | VEVGAHJWOYPTNJ-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|